ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate
Catalog No: FT-0708744
CAS No: 90924-54-2
- Chemical Name: ethyl 5-thiophen-2-yl-1,2-oxazole-3-carboxylate
- Molecular Formula: C10H9NO3S
- Molecular Weight: 223.25
- InChI Key: YPIUQIUZEYMWAX-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9NO3S/c1-2-13-10(12)7-6-8(14-11-7)9-4-3-5-15-9/h3-6H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 90924-54-2 |
|---|---|
| MF: | C10H9NO3S |
| Density: | 1.278g/cm3 |
| Flash_Point: | 183.4ºC |
| Melting_Point: | 47.5-51.5ºC |
| Product_Name: | Ethyl 5-(thiophen-2-yl)isoxazole-3-carboxylate |
| Symbol: | GHS07 |
| Bolling_Point: | 379.7ºC at 760 mmHg |
| FW: | 223.24800 |
| Density: | 1.278g/cm3 |
|---|---|
| MF: | C10H9NO3S |
| LogP: | 2.57980 |
| Melting_Point: | 47.5-51.5ºC |
| Exact_Mass: | 223.03000 |
| Bolling_Point: | 379.7ºC at 760 mmHg |
| Flash_Point: | 183.4ºC |
| FW: | 223.24800 |
| Refractive_Index: | 1.554 |
| PSA: | 80.57000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H319 |
| Warning_Statement: | P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)